C20H22N2O6 — CID 9438402
2-[[2-(4-formyl-2-methoxyphenoxy)acetyl]-methylamino]-N-(4-methoxyphenyl)acetamide (PubChem CID 9438402) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is 2-[[2-(4-formyl-2-methoxyphenoxy)acetyl]-methylamino]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[[2-(4-formyl-2-methoxyphenoxy)acetyl]-methylamino]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9438402 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-[[2-(4-formyl-2-methoxyphenoxy)acetyl]-methylamino]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN(C)C(=O)COc2ccc(C=O)cc2OC)cc1 |
| InChI | InChI=1S/C20H22N2O6/c1-22(11-19(24)21-15-5-7-16(26-2)8-6-15)20(25)13-28-17-9-4-14(12-23)10-18(17)27-3/h4-10,12H,11,13H2,1-3H3,(H,21,24) |
| InChIKey | OPCWALCXGJQPBB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|