C19H32N6O4 — CID 74686130
ethyl 4-[(3-methyl-2,6-dioxo-7-pentyl-4,5-dihydropurin-8-yl)methyl]piperazine-1-carboxylate (PubChem CID 74686130) has the molecular formula C19H32N6O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is ethyl 4-[(3-methyl-2,6-dioxo-7-pentyl-4,5-dihydropurin-8-yl)methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(3-methyl-2,6-dioxo-7-pentyl-4,5-dihydropurin-8-yl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 74686130 |
| Molecular Formula | C19H32N6O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | ethyl 4-[(3-methyl-2,6-dioxo-7-pentyl-4,5-dihydropurin-8-yl)methyl]piperazine-1-carboxylate |
| SMILES | CCCCCN1C(CN2CCN(C(=O)OCC)CC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C19H32N6O4/c1-4-6-7-8-25-14(20-16-15(25)17(26)21-18(27)22(16)3)13-23-9-11-24(12-10-23)19(28)29-5-2/h15-16H,4-13H2,1-3H3,(H,21,26,27) |
| InChIKey | KIVNYLNYADNYDG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|