C15H22N4O4 — CID 74700547
2-[7-(cyclohexanecarbonyl)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]acetamide (PubChem CID 74700547) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is 2-[7-(cyclohexanecarbonyl)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]acetamide.
| Compound Name | 2-[7-(cyclohexanecarbonyl)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]acetamide |
|---|---|
| PubChem CID | 74700547 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 2-[7-(cyclohexanecarbonyl)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]acetamide |
| SMILES | NC(=O)CN1C(=O)C2CN(C(=O)C3CCCCC3)CCN2C1=O |
| InChI | InChI=1S/C15H22N4O4/c16-12(20)9-19-14(22)11-8-17(6-7-18(11)15(19)23)13(21)10-4-2-1-3-5-10/h10-11H,1-9H2,(H2,16,20) |
| InChIKey | ASRKSWKSVGEZKN-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|