C19H19N2O5S- — CID 7470962
5-[(3R)-3-(2-hydroxy-3-methoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-5-oxopentanoate (PubChem CID 7470962) has the molecular formula C19H19N2O5S- and a molecular weight of 387.44 g/mol. Its IUPAC name is 5-[(3R)-3-(2-hydroxy-3-methoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-5-oxopentanoate.
| Compound Name | 5-[(3R)-3-(2-hydroxy-3-methoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-5-oxopentanoate |
|---|---|
| PubChem CID | 7470962 |
| Molecular Formula | C19H19N2O5S- |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 5-[(3R)-3-(2-hydroxy-3-methoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-5-oxopentanoate |
| SMILES | COc1cccc([C@H]2CC(c3cccs3)=NN2C(=O)CCCC(=O)[O-])c1O |
| InChI | InChI=1S/C19H20N2O5S/c1-26-15-6-2-5-12(19(15)25)14-11-13(16-7-4-10-27-16)20-21(14)17(22)8-3-9-18(23)24/h2,4-7,10,14,25H,3,8-9,11H2,1H3,(H,23,24)/p-1/t14-/m1/s1 |
| InChIKey | OWCYILXEZLGGGK-CQSZACIVSA-M |
| XLogP | 2.06 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|