C17H16N2O4S — CID 747126
(2S)-3-[(2R)-2-hydroxy-2-(4-nitrophenyl)ethyl]-2-phenyl-1,3-thiazolidin-4-one (PubChem CID 747126) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is (2S)-3-[(2R)-2-hydroxy-2-(4-nitrophenyl)ethyl]-2-phenyl-1,3-thiazolidin-4-one.
| Compound Name | (2S)-3-[(2R)-2-hydroxy-2-(4-nitrophenyl)ethyl]-2-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 747126 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (2S)-3-[(2R)-2-hydroxy-2-(4-nitrophenyl)ethyl]-2-phenyl-1,3-thiazolidin-4-one |
| SMILES | O=C1CS[C@@H](c2ccccc2)N1C[C@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H16N2O4S/c20-15(12-6-8-14(9-7-12)19(22)23)10-18-16(21)11-24-17(18)13-4-2-1-3-5-13/h1-9,15,17,20H,10-11H2/t15-,17-/m0/s1 |
| InChIKey | MGXILCXZIMQAAN-RDJZCZTQSA-N |
| XLogP | 2.90 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|