C25H34N2O7 — CID 74725322
2-[2-(dimethylamino)ethyl]-6-methoxy-1-(3,4,5-trimethoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 74725322) has the molecular formula C25H34N2O7 and a molecular weight of 474.55 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl]-6-methoxy-1-(3,4,5-trimethoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-[2-(dimethylamino)ethyl]-6-methoxy-1-(3,4,5-trimethoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 74725322 |
| Molecular Formula | C25H34N2O7 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl]-6-methoxy-1-(3,4,5-trimethoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COc1cc(C2C3=C(OC4CC(OC)CCC4C3=O)C(=O)N2CCN(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C25H34N2O7/c1-26(2)9-10-27-21(14-11-18(31-4)23(33-6)19(12-14)32-5)20-22(28)16-8-7-15(30-3)13-17(16)34-24(20)25(27)29/h11-12,15-17,21H,7-10,13H2,1-6H3 |
| InChIKey | IYLNGYZTYGSHKH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |