C23H30N2O5 — CID 78256352
1-(2,5-dimethoxyphenyl)-2-[2-(dimethylamino)ethyl]-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78256352) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-[2-(dimethylamino)ethyl]-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-[2-(dimethylamino)ethyl]-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78256352 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-[2-(dimethylamino)ethyl]-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COc1ccc(OC)c(C2C3=C(OC4CCCCC4C3=O)C(=O)N2CCN(C)C)c1 |
| InChI | InChI=1S/C23H30N2O5/c1-24(2)11-12-25-20(16-13-14(28-3)9-10-17(16)29-4)19-21(26)15-7-5-6-8-18(15)30-22(19)23(25)27/h9-10,13,15,18,20H,5-8,11-12H2,1-4H3 |
| InChIKey | AUGHNDZOKBFNQZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |