C22H23N5O3S2 — CID 74736902
6,7-dihydroxy-3-(4-pyrazol-1-ylphenyl)-2-sulfanylidene-N-(thiophen-2-ylmethyl)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide (PubChem CID 74736902) has the molecular formula C22H23N5O3S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is 6,7-dihydroxy-3-(4-pyrazol-1-ylphenyl)-2-sulfanylidene-N-(thiophen-2-ylmethyl)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | 6,7-dihydroxy-3-(4-pyrazol-1-ylphenyl)-2-sulfanylidene-N-(thiophen-2-ylmethyl)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 74736902 |
| Molecular Formula | C22H23N5O3S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 6,7-dihydroxy-3-(4-pyrazol-1-ylphenyl)-2-sulfanylidene-N-(thiophen-2-ylmethyl)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(NCc1cccs1)C1CC(O)C(O)C2NC(=S)N(c3ccc(-n4cccn4)cc3)C12 |
| InChI | InChI=1S/C22H23N5O3S2/c28-17-11-16(21(30)23-12-15-3-1-10-32-15)19-18(20(17)29)25-22(31)27(19)14-6-4-13(5-7-14)26-9-2-8-24-26/h1-10,16-20,28-29H,11-12H2,(H,23,30)(H,25,31) |
| InChIKey | KKSMNZNYIBGQGL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|