C23H24N6O3S — CID 74736903
6,7-dihydroxy-3-(4-pyrazol-1-ylphenyl)-N-(pyridin-3-ylmethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide (PubChem CID 74736903) has the molecular formula C23H24N6O3S and a molecular weight of 464.55 g/mol. Its IUPAC name is 6,7-dihydroxy-3-(4-pyrazol-1-ylphenyl)-N-(pyridin-3-ylmethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | 6,7-dihydroxy-3-(4-pyrazol-1-ylphenyl)-N-(pyridin-3-ylmethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 74736903 |
| Molecular Formula | C23H24N6O3S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 6,7-dihydroxy-3-(4-pyrazol-1-ylphenyl)-N-(pyridin-3-ylmethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(NCc1cccnc1)C1CC(O)C(O)C2NC(=S)N(c3ccc(-n4cccn4)cc3)C12 |
| InChI | InChI=1S/C23H24N6O3S/c30-18-11-17(22(32)25-13-14-3-1-8-24-12-14)20-19(21(18)31)27-23(33)29(20)16-6-4-15(5-7-16)28-10-2-9-26-28/h1-10,12,17-21,30-31H,11,13H2,(H,25,32)(H,27,33) |
| InChIKey | HNVUAFSORLCGDO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|