C16H14N2OS — CID 747378
2-(3,4-dimethylanilino)-3,1-benzothiazin-4-one (PubChem CID 747378) has the molecular formula C16H14N2OS and a molecular weight of 282.37 g/mol. Its IUPAC name is 2-(3,4-dimethylanilino)-3,1-benzothiazin-4-one.
| Compound Name | 2-(3,4-dimethylanilino)-3,1-benzothiazin-4-one |
|---|---|
| PubChem CID | 747378 |
| Molecular Formula | C16H14N2OS |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-(3,4-dimethylanilino)-3,1-benzothiazin-4-one |
| SMILES | Cc1ccc(Nc2nc3ccccc3c(=O)s2)cc1C |
| InChI | InChI=1S/C16H14N2OS/c1-10-7-8-12(9-11(10)2)17-16-18-14-6-4-3-5-13(14)15(19)20-16/h3-9H,1-2H3,(H,17,18) |
| InChIKey | SVELJKVKSCTKGB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |