C17H16N4O3S — CID 7474075
ethyl (2S)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-2-phenylacetate (PubChem CID 7474075) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is ethyl (2S)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-2-phenylacetate.
| Compound Name | ethyl (2S)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-2-phenylacetate |
|---|---|
| PubChem CID | 7474075 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | ethyl (2S)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-2-phenylacetate |
| SMILES | CCOC(=O)[C@@H](Sc1nnnn1-c1ccc(O)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H16N4O3S/c1-2-24-16(23)15(12-6-4-3-5-7-12)25-17-18-19-20-21(17)13-8-10-14(22)11-9-13/h3-11,15,22H,2H2,1H3/t15-/m0/s1 |
| InChIKey | BSECPDDLPVVILP-HNNXBMFYSA-N |
| XLogP | 2.76 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |