C23H20N4OS — CID 7865405
(2S)-1,2-bis(4-methylphenyl)-2-(1-phenyltetrazol-5-yl)sulfanylethanone (PubChem CID 7865405) has the molecular formula C23H20N4OS and a molecular weight of 400.51 g/mol. Its IUPAC name is (2S)-1,2-bis(4-methylphenyl)-2-(1-phenyltetrazol-5-yl)sulfanylethanone.
| Compound Name | (2S)-1,2-bis(4-methylphenyl)-2-(1-phenyltetrazol-5-yl)sulfanylethanone |
|---|---|
| PubChem CID | 7865405 |
| Molecular Formula | C23H20N4OS |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | (2S)-1,2-bis(4-methylphenyl)-2-(1-phenyltetrazol-5-yl)sulfanylethanone |
| SMILES | Cc1ccc(C(=O)[C@@H](Sc2nnnn2-c2ccccc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H20N4OS/c1-16-8-12-18(13-9-16)21(28)22(19-14-10-17(2)11-15-19)29-23-24-25-26-27(23)20-6-4-3-5-7-20/h3-15,22H,1-2H3/t22-/m0/s1 |
| InChIKey | UMUYIIFRHFCKPK-QFIPXVFZSA-N |
| XLogP | 5.00 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |