C24H19N5OS — CID 15945263
1-(1H-indol-3-yl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanyl-2-phenylethanone (PubChem CID 15945263) has the molecular formula C24H19N5OS and a molecular weight of 425.52 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanyl-2-phenylethanone.
| Compound Name | 1-(1H-indol-3-yl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanyl-2-phenylethanone |
|---|---|
| PubChem CID | 15945263 |
| Molecular Formula | C24H19N5OS |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 1-(1H-indol-3-yl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanyl-2-phenylethanone |
| SMILES | Cc1ccc(-n2nnnc2SC(C(=O)c2c[nH]c3ccccc23)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H19N5OS/c1-16-11-13-18(14-12-16)29-24(26-27-28-29)31-23(17-7-3-2-4-8-17)22(30)20-15-25-21-10-6-5-9-19(20)21/h2-15,23,25H,1H3 |
| InChIKey | PWJWHVAZLXMVNG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |