C23H17N5OS — CID 3571139
1-(1H-indol-3-yl)-2-phenyl-2-(1-phenyltetrazol-5-yl)sulfanylethanone (PubChem CID 3571139) has the molecular formula C23H17N5OS and a molecular weight of 411.49 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-2-phenyl-2-(1-phenyltetrazol-5-yl)sulfanylethanone.
| Compound Name | 1-(1H-indol-3-yl)-2-phenyl-2-(1-phenyltetrazol-5-yl)sulfanylethanone |
|---|---|
| PubChem CID | 3571139 |
| Molecular Formula | C23H17N5OS |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 1-(1H-indol-3-yl)-2-phenyl-2-(1-phenyltetrazol-5-yl)sulfanylethanone |
| SMILES | O=C(c1c[nH]c2ccccc12)C(Sc1nnnn1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H17N5OS/c29-21(19-15-24-20-14-8-7-13-18(19)20)22(16-9-3-1-4-10-16)30-23-25-26-27-28(23)17-11-5-2-6-12-17/h1-15,22,24H |
| InChIKey | AFSPJGKFYCZBKT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |