C21H28N4O3 — CID 7474354
5-[C-ethyl-N-(3-piperidin-1-ylpropyl)carbonimidoyl]-1-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 7474354) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 5-[C-ethyl-N-(3-piperidin-1-ylpropyl)carbonimidoyl]-1-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[C-ethyl-N-(3-piperidin-1-ylpropyl)carbonimidoyl]-1-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7474354 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 5-[C-ethyl-N-(3-piperidin-1-ylpropyl)carbonimidoyl]-1-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC/C(=N\CCCN1CCCCC1)C1C(=O)NC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C21H28N4O3/c1-2-17(22-12-9-15-24-13-7-4-8-14-24)18-19(26)23-21(28)25(20(18)27)16-10-5-3-6-11-16/h3,5-6,10-11,18H,2,4,7-9,12-15H2,1H3,(H,23,26,28)/b22-17+ |
| InChIKey | KVKMJZZPGVAEPG-OQKWZONESA-N |
| XLogP | 2.61 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|