C19H24N4O2S — CID 7367923
(5R)-1-methyl-3-phenyl-5-(2-piperidin-1-ylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7367923) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is (5R)-1-methyl-3-phenyl-5-(2-piperidin-1-ylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5R)-1-methyl-3-phenyl-5-(2-piperidin-1-ylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7367923 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (5R)-1-methyl-3-phenyl-5-(2-piperidin-1-ylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CN1C(=O)[C@@H](/C=N/CCN2CCCCC2)C(=O)N(c2ccccc2)C1=S |
| InChI | InChI=1S/C19H24N4O2S/c1-21-17(24)16(14-20-10-13-22-11-6-3-7-12-22)18(25)23(19(21)26)15-8-4-2-5-9-15/h2,4-5,8-9,14,16H,3,6-7,10-13H2,1H3/b20-14+/t16-/m1/s1 |
| InChIKey | FVTUXVGOVOTBIM-ZGPWBKFBSA-N |
| XLogP | 1.95 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|