C20H27N4O4S+ — CID 7475687
5-[(S)-(2,4-dimethoxyphenyl)-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-2-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol (PubChem CID 7475687) has the molecular formula C20H27N4O4S+ and a molecular weight of 419.53 g/mol. Its IUPAC name is 5-[(S)-(2,4-dimethoxyphenyl)-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-2-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol.
| Compound Name | 5-[(S)-(2,4-dimethoxyphenyl)-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-2-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
|---|---|
| PubChem CID | 7475687 |
| Molecular Formula | C20H27N4O4S+ |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 5-[(S)-(2,4-dimethoxyphenyl)-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-2-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
| SMILES | COc1ccc([C@@H](c2sc3nc(C)nn3c2O)[NH+]2C[C@@H](C)O[C@H](C)C2)c(OC)c1 |
| InChI | InChI=1S/C20H26N4O4S/c1-11-9-23(10-12(2)28-11)17(15-7-6-14(26-4)8-16(15)27-5)18-19(25)24-20(29-18)21-13(3)22-24/h6-8,11-12,17,25H,9-10H2,1-5H3/p+1/t11-,12-,17+/m1/s1 |
| InChIKey | RTIIPDREFQNAON-QFSBIZTOSA-O |
| XLogP | 1.60 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |