C18H23N4O3S+ — CID 2149303
5-[(S)-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-(3-methoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol (PubChem CID 2149303) has the molecular formula C18H23N4O3S+ and a molecular weight of 375.47 g/mol. Its IUPAC name is 5-[(S)-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-(3-methoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol.
| Compound Name | 5-[(S)-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-(3-methoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
|---|---|
| PubChem CID | 2149303 |
| Molecular Formula | C18H23N4O3S+ |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 5-[(S)-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-(3-methoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
| SMILES | COc1cccc([C@@H](c2sc3ncnn3c2O)[NH+]2C[C@@H](C)O[C@@H](C)C2)c1 |
| InChI | InChI=1S/C18H22N4O3S/c1-11-8-21(9-12(2)25-11)15(13-5-4-6-14(7-13)24-3)16-17(23)22-18(26-16)19-10-20-22/h4-7,10-12,15,23H,8-9H2,1-3H3/p+1/t11-,12+,15-/m0/s1 |
| InChIKey | CHYVAKAFGGCNES-ZOWXZIJZSA-O |
| XLogP | 1.29 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |