C15H19N4O2S2+ — CID 7172897
5-[(S)-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-thiophen-2-ylmethyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol (PubChem CID 7172897) has the molecular formula C15H19N4O2S2+ and a molecular weight of 351.48 g/mol. Its IUPAC name is 5-[(S)-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-thiophen-2-ylmethyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol.
| Compound Name | 5-[(S)-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-thiophen-2-ylmethyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
|---|---|
| PubChem CID | 7172897 |
| Molecular Formula | C15H19N4O2S2+ |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 5-[(S)-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-thiophen-2-ylmethyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
| SMILES | C[C@@H]1C[NH+]([C@@H](c2cccs2)c2sc3ncnn3c2O)C[C@@H](C)O1 |
| InChI | InChI=1S/C15H18N4O2S2/c1-9-6-18(7-10(2)21-9)12(11-4-3-5-22-11)13-14(20)19-15(23-13)16-8-17-19/h3-5,8-10,12,20H,6-7H2,1-2H3/p+1/t9-,10-,12+/m1/s1 |
| InChIKey | QTDKDDVKZDKMQU-FOGDFJRCSA-O |
| XLogP | 1.34 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |