C16H21N4O2S+ — CID 7172883
5-[(S)-[(3S,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-(furan-2-yl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol (PubChem CID 7172883) has the molecular formula C16H21N4O2S+ and a molecular weight of 333.44 g/mol. Its IUPAC name is 5-[(S)-[(3S,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-(furan-2-yl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol.
| Compound Name | 5-[(S)-[(3S,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-(furan-2-yl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
|---|---|
| PubChem CID | 7172883 |
| Molecular Formula | C16H21N4O2S+ |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 5-[(S)-[(3S,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-(furan-2-yl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
| SMILES | C[C@@H]1C[C@H](C)C[NH+]([C@@H](c2ccco2)c2sc3ncnn3c2O)C1 |
| InChI | InChI=1S/C16H20N4O2S/c1-10-6-11(2)8-19(7-10)13(12-4-3-5-22-12)14-15(21)20-16(23-14)17-9-18-20/h3-5,9-11,13,21H,6-8H2,1-2H3/p+1/t10-,11+,13-/m0/s1 |
| InChIKey | KAXXXNGRIHBNQM-LOWVWBTDSA-O |
| XLogP | 1.74 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |