C24H26N2O4S — CID 74759406
1-(4-ethoxyphenyl)-6,7-dimethyl-2-(1,3-thiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 74759406) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-6,7-dimethyl-2-(1,3-thiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-ethoxyphenyl)-6,7-dimethyl-2-(1,3-thiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 74759406 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 1-(4-ethoxyphenyl)-6,7-dimethyl-2-(1,3-thiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCOc1ccc(C2C3=C(OC4CC(C)C(C)CC4C3=O)C(=O)N2c2nccs2)cc1 |
| InChI | InChI=1S/C24H26N2O4S/c1-4-29-16-7-5-15(6-8-16)20-19-21(27)17-11-13(2)14(3)12-18(17)30-22(19)23(28)26(20)24-25-9-10-31-24/h5-10,13-14,17-18,20H,4,11-12H2,1-3H3 |
| InChIKey | NCDBXNAPYRWCOJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |