C20H19N3O4S — CID 78372215
6-methoxy-1-pyridin-2-yl-2-(1,3-thiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78372215) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is 6-methoxy-1-pyridin-2-yl-2-(1,3-thiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 6-methoxy-1-pyridin-2-yl-2-(1,3-thiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78372215 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 6-methoxy-1-pyridin-2-yl-2-(1,3-thiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COC1CCC2C(=O)C3=C(OC2C1)C(=O)N(c1nccs1)C3c1ccccn1 |
| InChI | InChI=1S/C20H19N3O4S/c1-26-11-5-6-12-14(10-11)27-18-15(17(12)24)16(13-4-2-3-7-21-13)23(19(18)25)20-22-8-9-28-20/h2-4,7-9,11-12,14,16H,5-6,10H2,1H3 |
| InChIKey | VZTGDFRIFOQRHL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |