C22H21BrN2O5S — CID 78254613
7-bromo-1-(2,5-dimethoxyphenyl)-2-(1,3-thiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78254613) has the molecular formula C22H21BrN2O5S and a molecular weight of 505.39 g/mol. Its IUPAC name is 7-bromo-1-(2,5-dimethoxyphenyl)-2-(1,3-thiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-1-(2,5-dimethoxyphenyl)-2-(1,3-thiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78254613 |
| Molecular Formula | C22H21BrN2O5S |
| Molecular Weight | 505.39 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | 7-bromo-1-(2,5-dimethoxyphenyl)-2-(1,3-thiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COc1ccc(OC)c(C2C3=C(OC4CCC(Br)CC4C3=O)C(=O)N2c2nccs2)c1 |
| InChI | InChI=1S/C22H21BrN2O5S/c1-28-12-4-6-15(29-2)13(10-12)18-17-19(26)14-9-11(23)3-5-16(14)30-20(17)21(27)25(18)22-24-7-8-31-22/h4,6-8,10-11,14,16,18H,3,5,9H2,1-2H3 |
| InChIKey | QUMVRDGUDHPSLR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|