C23H25N3O6S — CID 74725187
1-(2,3-dimethoxyphenyl)-6-methoxy-2-(5-methyl-1,3,4-thiadiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 74725187) has the molecular formula C23H25N3O6S and a molecular weight of 471.54 g/mol. Its IUPAC name is 1-(2,3-dimethoxyphenyl)-6-methoxy-2-(5-methyl-1,3,4-thiadiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(2,3-dimethoxyphenyl)-6-methoxy-2-(5-methyl-1,3,4-thiadiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 74725187 |
| Molecular Formula | C23H25N3O6S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 1-(2,3-dimethoxyphenyl)-6-methoxy-2-(5-methyl-1,3,4-thiadiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COc1cccc(C2C3=C(OC4CC(OC)CCC4C3=O)C(=O)N2c2nnc(C)s2)c1OC |
| InChI | InChI=1S/C23H25N3O6S/c1-11-24-25-23(33-11)26-18(14-6-5-7-15(30-3)20(14)31-4)17-19(27)13-9-8-12(29-2)10-16(13)32-21(17)22(26)28/h5-7,12-13,16,18H,8-10H2,1-4H3 |
| InChIKey | TVNRUUZDLXPSQL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 100.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |