C26H24N2O5S — CID 74773892
2-(1,3-benzothiazol-2-yl)-1-(2,3-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 74773892) has the molecular formula C26H24N2O5S and a molecular weight of 476.55 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-(2,3-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-(2,3-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 74773892 |
| Molecular Formula | C26H24N2O5S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-(2,3-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COc1cccc(C2C3=C(OC4CCCCC4C3=O)C(=O)N2c2nc3ccccc3s2)c1OC |
| InChI | InChI=1S/C26H24N2O5S/c1-31-18-12-7-9-15(23(18)32-2)21-20-22(29)14-8-3-5-11-17(14)33-24(20)25(30)28(21)26-27-16-10-4-6-13-19(16)34-26/h4,6-7,9-10,12-14,17,21H,3,5,8,11H2,1-2H3 |
| InChIKey | PYUVDGSHIICLTH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |