C24H29NO3P2S — CID 74763046
(1R)-1-diethoxyphosphoryl-N-diphenylphosphinothioyl-1-phenylethanamine (PubChem CID 74763046) has the molecular formula C24H29NO3P2S and a molecular weight of 473.52 g/mol. Its IUPAC name is (1R)-1-diethoxyphosphoryl-N-diphenylphosphinothioyl-1-phenylethanamine.
| Compound Name | (1R)-1-diethoxyphosphoryl-N-diphenylphosphinothioyl-1-phenylethanamine |
|---|---|
| PubChem CID | 74763046 |
| Molecular Formula | C24H29NO3P2S |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | (1R)-1-diethoxyphosphoryl-N-diphenylphosphinothioyl-1-phenylethanamine |
| SMILES | CCOP(=O)(OCC)[C@@](C)(NP(=S)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H29NO3P2S/c1-4-27-30(26,28-5-2)24(3,21-15-9-6-10-16-21)25-29(31,22-17-11-7-12-18-22)23-19-13-8-14-20-23/h6-20H,4-5H2,1-3H3,(H,25,31)/t24-/m1/s1 |
| InChIKey | NICAOUNJEFWVBT-XMMPIXPASA-N |
| XLogP | 5.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|