C20H25N3O5S2 — CID 74763673
N-[2-[[7-(3,4-dimethoxyphenyl)-5-methyl-4-oxothieno[3,2-c]pyridin-2-yl]methylamino]ethyl]methanesulfonamide (PubChem CID 74763673) has the molecular formula C20H25N3O5S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-[2-[[7-(3,4-dimethoxyphenyl)-5-methyl-4-oxothieno[3,2-c]pyridin-2-yl]methylamino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[7-(3,4-dimethoxyphenyl)-5-methyl-4-oxothieno[3,2-c]pyridin-2-yl]methylamino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 74763673 |
| Molecular Formula | C20H25N3O5S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | N-[2-[[7-(3,4-dimethoxyphenyl)-5-methyl-4-oxothieno[3,2-c]pyridin-2-yl]methylamino]ethyl]methanesulfonamide |
| SMILES | COc1ccc(-c2cn(C)c(=O)c3cc(CNCCNS(C)(=O)=O)sc23)cc1OC |
| InChI | InChI=1S/C20H25N3O5S2/c1-23-12-16(13-5-6-17(27-2)18(9-13)28-3)19-15(20(23)24)10-14(29-19)11-21-7-8-22-30(4,25)26/h5-6,9-10,12,21-22H,7-8,11H2,1-4H3 |
| InChIKey | SMVHNEADENMQJL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|