C17H17N3O3S — CID 154670994
7-(3,4-dimethoxyphenyl)-5-methyl-4-oxothieno[3,2-c]pyridine-2-carboximidamide (PubChem CID 154670994) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 7-(3,4-dimethoxyphenyl)-5-methyl-4-oxothieno[3,2-c]pyridine-2-carboximidamide.
| Compound Name | 7-(3,4-dimethoxyphenyl)-5-methyl-4-oxothieno[3,2-c]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 154670994 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 7-(3,4-dimethoxyphenyl)-5-methyl-4-oxothieno[3,2-c]pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc2c(=O)n(C)cc(-c3ccc(OC)c(OC)c3)c2s1 |
| InChI | InChI=1S/C17H17N3O3S/c1-20-8-11(9-4-5-12(22-2)13(6-9)23-3)15-10(17(20)21)7-14(24-15)16(18)19/h4-8H,1-3H3,(H3,18,19) |
| InChIKey | JHXHSOFNVAALKU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|