About 5-[5-(3,4,5-trimethoxyphenyl)thiophen-2-yl]thiophene-2-carboximidamide
5-[5-(3,4,5-trimethoxyphenyl)thiophen-2-yl]thiophene-2-carboximidamide (PubChem CID 155515500) has the molecular formula C18H18N2O3S2
and a molecular weight of 374.49 g/mol. Its IUPAC name is 5-[5-(3,4,5-trimethoxyphenyl)thiophen-2-yl]thiophene-2-carboximidamide.
Molecular Properties
| Compound Name | 5-[5-(3,4,5-trimethoxyphenyl)thiophen-2-yl]thiophene-2-carboximidamide |
| PubChem CID | 155515500 |
| Molecular Formula | C18H18N2O3S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 5-[5-(3,4,5-trimethoxyphenyl)thiophen-2-yl]thiophene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(-c3cc(OC)c(OC)c(OC)c3)s2)s1 |
| InChI | InChI=1S/C18H18N2O3S2/c1-21-11-8-10(9-12(22-2)17(11)23-3)13-4-5-14(24-13)15-6-7-16(25-15)18(19)20/h4-9H,1-3H3,(H3,19,20) |
| InChIKey | NINVANNCPHSLNN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-(3,4,5-trimethoxyphenyl)thiophen-2-yl]thiophene-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(3,4,5-trimethoxyphenyl)thiophen-2-yl]thiophene-2-carboximidamide?
The IUPAC name of 5-[5-(3,4,5-trimethoxyphenyl)thiophen-2-yl]thiophene-2-carboximidamide (CID 155515500) is 5-[5-(3,4,5-trimethoxyphenyl)thiophen-2-yl]thiophene-2-carboximidamide.
What is the SMILES notation for 5-[5-(3,4,5-trimethoxyphenyl)thiophen-2-yl]thiophene-2-carboximidamide?
The canonical SMILES for 5-[5-(3,4,5-trimethoxyphenyl)thiophen-2-yl]thiophene-2-carboximidamide is [H]/N=C(\N)c1ccc(-c2ccc(-c3cc(OC)c(OC)c(OC)c3)s2)s1.
What is the InChIKey of 5-[5-(3,4,5-trimethoxyphenyl)thiophen-2-yl]thiophene-2-carboximidamide?
The InChIKey is NINVANNCPHSLNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O3S2/c1-21-11-8-10(9-12(22-2)17(11)23-3)13-4-5-14(24-13)15-6-7-16(25-15)18(19)20/h4-9H,1-3H3,(H3,19,20).
What are the key properties of 5-[5-(3,4,5-trimethoxyphenyl)thiophen-2-yl]thiophene-2-carboximidamide?
5-[5-(3,4,5-trimethoxyphenyl)thiophen-2-yl]thiophene-2-carboximidamide has a molecular weight of 374.49 g/mol, XLogP of 4.45, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(3,4,5-trimethoxyphenyl)thiophen-2-yl]thiophene-2-carboximidamide is sourced from PubChem (CID 155515500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).