C18H18N2O3S2 — CID 155515500
5-[5-(3,4,5-trimethoxyphenyl)thiophen-2-yl]thiophene-2-carboximidamide (PubChem CID 155515500) has the molecular formula C18H18N2O3S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 5-[5-(3,4,5-trimethoxyphenyl)thiophen-2-yl]thiophene-2-carboximidamide.
| Compound Name | 5-[5-(3,4,5-trimethoxyphenyl)thiophen-2-yl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 155515500 |
| Molecular Formula | C18H18N2O3S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 5-[5-(3,4,5-trimethoxyphenyl)thiophen-2-yl]thiophene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(-c3cc(OC)c(OC)c(OC)c3)s2)s1 |
| InChI | InChI=1S/C18H18N2O3S2/c1-21-11-8-10(9-12(22-2)17(11)23-3)13-4-5-14(24-13)15-6-7-16(25-15)18(19)20/h4-9H,1-3H3,(H3,19,20) |
| InChIKey | NINVANNCPHSLNN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|