C23H27N3O5S3 — CID 155459869
N'-(1,1-dioxothian-4-yl)-7-[3-methoxy-4-(methylsulfanylmethoxy)phenyl]-5-methyl-4-oxothieno[3,2-c]pyridine-2-carboximidamide (PubChem CID 155459869) has the molecular formula C23H27N3O5S3 and a molecular weight of 521.69 g/mol. Its IUPAC name is N'-(1,1-dioxothian-4-yl)-7-[3-methoxy-4-(methylsulfanylmethoxy)phenyl]-5-methyl-4-oxothieno[3,2-c]pyridine-2-carboximidamide.
| Compound Name | N'-(1,1-dioxothian-4-yl)-7-[3-methoxy-4-(methylsulfanylmethoxy)phenyl]-5-methyl-4-oxothieno[3,2-c]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 155459869 |
| Molecular Formula | C23H27N3O5S3 |
| Molecular Weight | 521.69 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | N'-(1,1-dioxothian-4-yl)-7-[3-methoxy-4-(methylsulfanylmethoxy)phenyl]-5-methyl-4-oxothieno[3,2-c]pyridine-2-carboximidamide |
| SMILES | COc1cc(-c2cn(C)c(=O)c3cc(/C(N)=N/C4CCS(=O)(=O)CC4)sc23)ccc1OCSC |
| InChI | InChI=1S/C23H27N3O5S3/c1-26-12-17(14-4-5-18(31-13-32-3)19(10-14)30-2)21-16(23(26)27)11-20(33-21)22(24)25-15-6-8-34(28,29)9-7-15/h4-5,10-12,15H,6-9,13H2,1-3H3,(H2,24,25) |
| InChIKey | SVLUMNNFWNQLQY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.69 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|