C23H22F3N3O6S2 — CID 154671507
2-[4-[2-[N'-(1,1-dioxothian-4-yl)carbamimidoyl]-5-methyl-4-oxothieno[3,2-c]pyridin-7-yl]-2-(trifluoromethyl)phenoxy]acetic acid (PubChem CID 154671507) has the molecular formula C23H22F3N3O6S2 and a molecular weight of 557.57 g/mol. Its IUPAC name is 2-[4-[2-[N'-(1,1-dioxothian-4-yl)carbamimidoyl]-5-methyl-4-oxothieno[3,2-c]pyridin-7-yl]-2-(trifluoromethyl)phenoxy]acetic acid.
| Compound Name | 2-[4-[2-[N'-(1,1-dioxothian-4-yl)carbamimidoyl]-5-methyl-4-oxothieno[3,2-c]pyridin-7-yl]-2-(trifluoromethyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 154671507 |
| Molecular Formula | C23H22F3N3O6S2 |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 557.09 |
| IUPAC Name | 2-[4-[2-[N'-(1,1-dioxothian-4-yl)carbamimidoyl]-5-methyl-4-oxothieno[3,2-c]pyridin-7-yl]-2-(trifluoromethyl)phenoxy]acetic acid |
| SMILES | Cn1cc(-c2ccc(OCC(=O)O)c(C(F)(F)F)c2)c2sc(/C(N)=N/C3CCS(=O)(=O)CC3)cc2c1=O |
| InChI | InChI=1S/C23H22F3N3O6S2/c1-29-10-15(12-2-3-17(35-11-19(30)31)16(8-12)23(24,25)26)20-14(22(29)32)9-18(36-20)21(27)28-13-4-6-37(33,34)7-5-13/h2-3,8-10,13H,4-7,11H2,1H3,(H2,27,28)(H,30,31) |
| InChIKey | UNDGAZDNZNWWBZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 141.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|