C10H15FN4 — CID 74764290
4-N-cyclohexyl-6-fluoropyrimidine-2,4-diamine (PubChem CID 74764290) has the molecular formula C10H15FN4 and a molecular weight of 210.26 g/mol. Its IUPAC name is 4-N-cyclohexyl-6-fluoropyrimidine-2,4-diamine.
| Compound Name | 4-N-cyclohexyl-6-fluoropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 74764290 |
| Molecular Formula | C10H15FN4 |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 4-N-cyclohexyl-6-fluoropyrimidine-2,4-diamine |
| SMILES | Nc1nc(F)cc(NC2CCCCC2)n1 |
| InChI | InChI=1S/C10H15FN4/c11-8-6-9(15-10(12)14-8)13-7-4-2-1-3-5-7/h6-7H,1-5H2,(H3,12,13,14,15) |
| InChIKey | KPYBWAMDQCMSRY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |