C17H17ClN2 — CID 74764423
hydron;N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline;chloride (PubChem CID 74764423) has the molecular formula C17H17ClN2 and a molecular weight of 284.79 g/mol. Its IUPAC name is hydron;N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline;chloride.
| Compound Name | hydron;N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline;chloride |
|---|---|
| PubChem CID | 74764423 |
| Molecular Formula | C17H17ClN2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | hydron;N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline;chloride |
| SMILES | C(=C/C=N/c1ccccc1)\C=C\Nc1ccccc1.[Cl-].[H+] |
| InChI | InChI=1S/C17H16N2.ClH/c1-4-10-16(11-5-1)18-14-8-3-9-15-19-17-12-6-2-7-13-17;/h1-15,18H;1H/b9-3+,14-8+,19-15+; |
| InChIKey | VUCMMJBDNXZQDJ-SAIFEKGMSA-N |
| XLogP | 1.69 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|