C31H26ClNO4 — CID 74765178
9H-fluoren-9-ylmethyl N-[(2S)-3-(2-benzyl-4-hydroxyphenyl)-1-chloro-1-oxopropan-2-yl]carbamate (PubChem CID 74765178) has the molecular formula C31H26ClNO4 and a molecular weight of 512.01 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-3-(2-benzyl-4-hydroxyphenyl)-1-chloro-1-oxopropan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-3-(2-benzyl-4-hydroxyphenyl)-1-chloro-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 74765178 |
| Molecular Formula | C31H26ClNO4 |
| Molecular Weight | 512.01 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-3-(2-benzyl-4-hydroxyphenyl)-1-chloro-1-oxopropan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccc(O)cc1Cc1ccccc1)C(=O)Cl)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H26ClNO4/c32-30(35)29(18-21-14-15-23(34)17-22(21)16-20-8-2-1-3-9-20)33-31(36)37-19-28-26-12-6-4-10-24(26)25-11-5-7-13-27(25)28/h1-15,17,28-29,34H,16,18-19H2,(H,33,36)/t29-/m0/s1 |
| InChIKey | MNTGPHNDJLIMSU-LJAQVGFWSA-N |
| XLogP | 6.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.01 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|