C12H11FN4O5S2 — CID 74766010
1-(4-fluorophenyl)sulfonyl-3-(6-sulfamoyl-3-pyridinyl)urea (PubChem CID 74766010) has the molecular formula C12H11FN4O5S2 and a molecular weight of 374.38 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-3-(6-sulfamoyl-3-pyridinyl)urea.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-3-(6-sulfamoyl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 74766010 |
| Molecular Formula | C12H11FN4O5S2 |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-3-(6-sulfamoyl-3-pyridinyl)urea |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)NS(=O)(=O)c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C12H11FN4O5S2/c13-8-1-4-10(5-2-8)24(21,22)17-12(18)16-9-3-6-11(15-7-9)23(14,19)20/h1-7H,(H2,14,19,20)(H2,16,17,18) |
| InChIKey | IQSPZQMMEJIGTG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 148.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |