C18H15N3O3S — CID 66610600
1-[4-(benzenesulfonyl)phenyl]-3-pyridin-3-ylurea (PubChem CID 66610600) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)phenyl]-3-pyridin-3-ylurea.
| Compound Name | 1-[4-(benzenesulfonyl)phenyl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 66610600 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 1-[4-(benzenesulfonyl)phenyl]-3-pyridin-3-ylurea |
| SMILES | O=C(Nc1ccc(S(=O)(=O)c2ccccc2)cc1)Nc1cccnc1 |
| InChI | InChI=1S/C18H15N3O3S/c22-18(21-15-5-4-12-19-13-15)20-14-8-10-17(11-9-14)25(23,24)16-6-2-1-3-7-16/h1-13H,(H2,20,21,22) |
| InChIKey | SUTPKGOERYDKLQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |