C16H17Cl2NO3S — CID 74768382
2,6-dichloro-N-[1-(4-ethoxyphenyl)ethyl]benzenesulfonamide (PubChem CID 74768382) has the molecular formula C16H17Cl2NO3S and a molecular weight of 374.29 g/mol. Its IUPAC name is 2,6-dichloro-N-[1-(4-ethoxyphenyl)ethyl]benzenesulfonamide.
| Compound Name | 2,6-dichloro-N-[1-(4-ethoxyphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 74768382 |
| Molecular Formula | C16H17Cl2NO3S |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 2,6-dichloro-N-[1-(4-ethoxyphenyl)ethyl]benzenesulfonamide |
| SMILES | CCOc1ccc(C(C)NS(=O)(=O)c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C16H17Cl2NO3S/c1-3-22-13-9-7-12(8-10-13)11(2)19-23(20,21)16-14(17)5-4-6-15(16)18/h4-11,19H,3H2,1-2H3 |
| InChIKey | AENWXFDXLAYNJB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |