C17H19Cl2NO3S — CID 43905164
1-(2,4-dichlorophenyl)-N-[1-(4-ethoxyphenyl)ethyl]methanesulfonamide (PubChem CID 43905164) has the molecular formula C17H19Cl2NO3S and a molecular weight of 388.32 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-[1-(4-ethoxyphenyl)ethyl]methanesulfonamide.
| Compound Name | 1-(2,4-dichlorophenyl)-N-[1-(4-ethoxyphenyl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 43905164 |
| Molecular Formula | C17H19Cl2NO3S |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-[1-(4-ethoxyphenyl)ethyl]methanesulfonamide |
| SMILES | CCOc1ccc(C(C)NS(=O)(=O)Cc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H19Cl2NO3S/c1-3-23-16-8-5-13(6-9-16)12(2)20-24(21,22)11-14-4-7-15(18)10-17(14)19/h4-10,12,20H,3,11H2,1-2H3 |
| InChIKey | CQYMZVCUQGHRGQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |