C21H19FN6O2 — CID 74770094
5-[(2-fluorophenyl)methyl]-1-methyl-8-(4-methylphenyl)-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione (PubChem CID 74770094) has the molecular formula C21H19FN6O2 and a molecular weight of 406.42 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)methyl]-1-methyl-8-(4-methylphenyl)-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione.
| Compound Name | 5-[(2-fluorophenyl)methyl]-1-methyl-8-(4-methylphenyl)-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione |
|---|---|
| PubChem CID | 74770094 |
| Molecular Formula | C21H19FN6O2 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 5-[(2-fluorophenyl)methyl]-1-methyl-8-(4-methylphenyl)-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione |
| SMILES | Cc1ccc(-c2nnc3n2C2C(C(=O)NC(=O)N2C)N3Cc2ccccc2F)cc1 |
| InChI | InChI=1S/C21H19FN6O2/c1-12-7-9-13(10-8-12)17-24-25-20-27(11-14-5-3-4-6-15(14)22)16-18(29)23-21(30)26(2)19(16)28(17)20/h3-10,16,19H,11H2,1-2H3,(H,23,29,30) |
| InChIKey | HXXCXTLPCBKWKP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |