C28H26N6O3 — CID 74525887
1-methyl-5-[(2-methylphenyl)methyl]-8-(4-phenylmethoxyphenyl)-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione (PubChem CID 74525887) has the molecular formula C28H26N6O3 and a molecular weight of 494.56 g/mol. Its IUPAC name is 1-methyl-5-[(2-methylphenyl)methyl]-8-(4-phenylmethoxyphenyl)-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione.
| Compound Name | 1-methyl-5-[(2-methylphenyl)methyl]-8-(4-phenylmethoxyphenyl)-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione |
|---|---|
| PubChem CID | 74525887 |
| Molecular Formula | C28H26N6O3 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 1-methyl-5-[(2-methylphenyl)methyl]-8-(4-phenylmethoxyphenyl)-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione |
| SMILES | Cc1ccccc1CN1c2nnc(-c3ccc(OCc4ccccc4)cc3)n2C2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C28H26N6O3/c1-18-8-6-7-11-21(18)16-33-23-25(35)29-28(36)32(2)26(23)34-24(30-31-27(33)34)20-12-14-22(15-13-20)37-17-19-9-4-3-5-10-19/h3-15,23,26H,16-17H2,1-2H3,(H,29,35,36) |
| InChIKey | ARVHULKJOCXEIC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |