C18H22N6O2 — CID 74770162
5-butyl-1,3-dimethyl-8-phenyl-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione (PubChem CID 74770162) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 5-butyl-1,3-dimethyl-8-phenyl-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione.
| Compound Name | 5-butyl-1,3-dimethyl-8-phenyl-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione |
|---|---|
| PubChem CID | 74770162 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 5-butyl-1,3-dimethyl-8-phenyl-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione |
| SMILES | CCCCN1c2nnc(-c3ccccc3)n2C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C18H22N6O2/c1-4-5-11-23-13-15(21(2)18(26)22(3)16(13)25)24-14(19-20-17(23)24)12-9-7-6-8-10-12/h6-10,13,15H,4-5,11H2,1-3H3 |
| InChIKey | VHKMYIWJOZOXNM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |