C23H24N6O3 — CID 74536786
5-benzyl-8-(4-ethoxyphenyl)-1,3-dimethyl-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione (PubChem CID 74536786) has the molecular formula C23H24N6O3 and a molecular weight of 432.48 g/mol. Its IUPAC name is 5-benzyl-8-(4-ethoxyphenyl)-1,3-dimethyl-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione.
| Compound Name | 5-benzyl-8-(4-ethoxyphenyl)-1,3-dimethyl-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione |
|---|---|
| PubChem CID | 74536786 |
| Molecular Formula | C23H24N6O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 5-benzyl-8-(4-ethoxyphenyl)-1,3-dimethyl-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione |
| SMILES | CCOc1ccc(-c2nnc3n2C2C(C(=O)N(C)C(=O)N2C)N3Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N6O3/c1-4-32-17-12-10-16(11-13-17)19-24-25-22-28(14-15-8-6-5-7-9-15)18-20(29(19)22)26(2)23(31)27(3)21(18)30/h5-13,18,20H,4,14H2,1-3H3 |
| InChIKey | LIXKERKHKGZWAF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |