C21H18ClFN6O2 — CID 74770173
5-benzyl-8-(2-chloro-6-fluorophenyl)-1,3-dimethyl-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione (PubChem CID 74770173) has the molecular formula C21H18ClFN6O2 and a molecular weight of 440.87 g/mol. Its IUPAC name is 5-benzyl-8-(2-chloro-6-fluorophenyl)-1,3-dimethyl-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione.
| Compound Name | 5-benzyl-8-(2-chloro-6-fluorophenyl)-1,3-dimethyl-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione |
|---|---|
| PubChem CID | 74770173 |
| Molecular Formula | C21H18ClFN6O2 |
| Molecular Weight | 440.87 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 5-benzyl-8-(2-chloro-6-fluorophenyl)-1,3-dimethyl-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione |
| SMILES | CN1C(=O)C2C(N(C)C1=O)n1c(-c3c(F)cccc3Cl)nnc1N2Cc1ccccc1 |
| InChI | InChI=1S/C21H18ClFN6O2/c1-26-18-16(19(30)27(2)21(26)31)28(11-12-7-4-3-5-8-12)20-25-24-17(29(18)20)15-13(22)9-6-10-14(15)23/h3-10,16,18H,11H2,1-2H3 |
| InChIKey | GLKDGESWDXOSAM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.87 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |