C23H29N3O4 — CID 7477348
1-[[(1S,2R)-2-(4-tert-butylphenyl)cyclopropanecarbonyl]amino]-3-(2,4-dimethoxyphenyl)urea (PubChem CID 7477348) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 1-[[(1S,2R)-2-(4-tert-butylphenyl)cyclopropanecarbonyl]amino]-3-(2,4-dimethoxyphenyl)urea.
| Compound Name | 1-[[(1S,2R)-2-(4-tert-butylphenyl)cyclopropanecarbonyl]amino]-3-(2,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 7477348 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 1-[[(1S,2R)-2-(4-tert-butylphenyl)cyclopropanecarbonyl]amino]-3-(2,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NNC(=O)[C@H]2C[C@H]2c2ccc(C(C)(C)C)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H29N3O4/c1-23(2,3)15-8-6-14(7-9-15)17-13-18(17)21(27)25-26-22(28)24-19-11-10-16(29-4)12-20(19)30-5/h6-12,17-18H,13H2,1-5H3,(H,25,27)(H2,24,26,28)/t17-,18-/m0/s1 |
| InChIKey | DRQVCBDHIVFVIS-ROUUACIJSA-N |
| XLogP | 3.96 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|