C18H17F2N3O2 — CID 27518691
1-(2,4-difluorophenyl)-3-[[(1S,2R)-2-(4-methylphenyl)cyclopropanecarbonyl]amino]urea (PubChem CID 27518691) has the molecular formula C18H17F2N3O2 and a molecular weight of 345.35 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[[(1S,2R)-2-(4-methylphenyl)cyclopropanecarbonyl]amino]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[[(1S,2R)-2-(4-methylphenyl)cyclopropanecarbonyl]amino]urea |
|---|---|
| PubChem CID | 27518691 |
| Molecular Formula | C18H17F2N3O2 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[[(1S,2R)-2-(4-methylphenyl)cyclopropanecarbonyl]amino]urea |
| SMILES | Cc1ccc([C@@H]2C[C@@H]2C(=O)NNC(=O)Nc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C18H17F2N3O2/c1-10-2-4-11(5-3-10)13-9-14(13)17(24)22-23-18(25)21-16-7-6-12(19)8-15(16)20/h2-8,13-14H,9H2,1H3,(H,22,24)(H2,21,23,25)/t13-,14-/m0/s1 |
| InChIKey | VLALPGGKAKEWHT-KBPBESRZSA-N |
| XLogP | 3.23 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|