C19H21N3OS — CID 843482
1-(3-methylphenyl)-3-[[(1S,2S)-2-(4-methylphenyl)cyclopropanecarbonyl]amino]thiourea (PubChem CID 843482) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-[[(1S,2S)-2-(4-methylphenyl)cyclopropanecarbonyl]amino]thiourea.
| Compound Name | 1-(3-methylphenyl)-3-[[(1S,2S)-2-(4-methylphenyl)cyclopropanecarbonyl]amino]thiourea |
|---|---|
| PubChem CID | 843482 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 1-(3-methylphenyl)-3-[[(1S,2S)-2-(4-methylphenyl)cyclopropanecarbonyl]amino]thiourea |
| SMILES | Cc1ccc([C@H]2C[C@@H]2C(=O)NNC(=S)Nc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C19H21N3OS/c1-12-6-8-14(9-7-12)16-11-17(16)18(23)21-22-19(24)20-15-5-3-4-13(2)10-15/h3-10,16-17H,11H2,1-2H3,(H,21,23)(H2,20,22,24)/t16-,17+/m1/s1 |
| InChIKey | ZWQAAAAGSDREOQ-SJORKVTESA-N |
| XLogP | 3.42 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|