C18H21N5OS — CID 78364812
1-[[5-(4-methylphenyl)pyrazolidine-3-carbonyl]amino]-3-phenylthiourea (PubChem CID 78364812) has the molecular formula C18H21N5OS and a molecular weight of 355.47 g/mol. Its IUPAC name is 1-[[5-(4-methylphenyl)pyrazolidine-3-carbonyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[5-(4-methylphenyl)pyrazolidine-3-carbonyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 78364812 |
| Molecular Formula | C18H21N5OS |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-[[5-(4-methylphenyl)pyrazolidine-3-carbonyl]amino]-3-phenylthiourea |
| SMILES | Cc1ccc(C2CC(C(=O)NNC(=S)Nc3ccccc3)NN2)cc1 |
| InChI | InChI=1S/C18H21N5OS/c1-12-7-9-13(10-8-12)15-11-16(21-20-15)17(24)22-23-18(25)19-14-5-3-2-4-6-14/h2-10,15-16,20-21H,11H2,1H3,(H,22,24)(H2,19,23,25) |
| InChIKey | ZKNNNUFTUUNQQN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|