C20H25N3O4 — CID 74459525
5-(4-methylphenyl)-N-(3,4,5-trimethoxyphenyl)pyrazolidine-3-carboxamide (PubChem CID 74459525) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 5-(4-methylphenyl)-N-(3,4,5-trimethoxyphenyl)pyrazolidine-3-carboxamide.
| Compound Name | 5-(4-methylphenyl)-N-(3,4,5-trimethoxyphenyl)pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 74459525 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 5-(4-methylphenyl)-N-(3,4,5-trimethoxyphenyl)pyrazolidine-3-carboxamide |
| SMILES | COc1cc(NC(=O)C2CC(c3ccc(C)cc3)NN2)cc(OC)c1OC |
| InChI | InChI=1S/C20H25N3O4/c1-12-5-7-13(8-6-12)15-11-16(23-22-15)20(24)21-14-9-17(25-2)19(27-4)18(10-14)26-3/h5-10,15-16,22-23H,11H2,1-4H3,(H,21,24) |
| InChIKey | AIEPAFMEOKSGPZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |