C17H20N4O3 — CID 75975396
N-(3,4-dimethoxyphenyl)-5-pyridin-4-ylpyrazolidine-3-carboxamide (PubChem CID 75975396) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-5-pyridin-4-ylpyrazolidine-3-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-5-pyridin-4-ylpyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 75975396 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-5-pyridin-4-ylpyrazolidine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CC(c3ccncc3)NN2)cc1OC |
| InChI | InChI=1S/C17H20N4O3/c1-23-15-4-3-12(9-16(15)24-2)19-17(22)14-10-13(20-21-14)11-5-7-18-8-6-11/h3-9,13-14,20-21H,10H2,1-2H3,(H,19,22) |
| InChIKey | PRNXLXRSDLPXCE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |