C19H23N3O — CID 75605659
N-(3,5-dimethylphenyl)-5-(4-methylphenyl)pyrazolidine-3-carboxamide (PubChem CID 75605659) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-5-(4-methylphenyl)pyrazolidine-3-carboxamide.
| Compound Name | N-(3,5-dimethylphenyl)-5-(4-methylphenyl)pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 75605659 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | N-(3,5-dimethylphenyl)-5-(4-methylphenyl)pyrazolidine-3-carboxamide |
| SMILES | Cc1ccc(C2CC(C(=O)Nc3cc(C)cc(C)c3)NN2)cc1 |
| InChI | InChI=1S/C19H23N3O/c1-12-4-6-15(7-5-12)17-11-18(22-21-17)19(23)20-16-9-13(2)8-14(3)10-16/h4-10,17-18,21-22H,11H2,1-3H3,(H,20,23) |
| InChIKey | ANVQXCJUUOKDKH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |